C12H18N+ — CID 123452256
3-but-2-enylidene-2-ethylidene-1,1-dimethylpyrrol-1-ium (PubChem CID 123452256) has the molecular formula C12H18N+ and a molecular weight of 176.28 g/mol. Its IUPAC name is 3-but-2-enylidene-2-ethylidene-1,1-dimethylpyrrol-1-ium.
| Compound Name | 3-but-2-enylidene-2-ethylidene-1,1-dimethylpyrrol-1-ium |
|---|---|
| PubChem CID | 123452256 |
| Molecular Formula | C12H18N+ |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.14 |
| IUPAC Name | 3-but-2-enylidene-2-ethylidene-1,1-dimethylpyrrol-1-ium |
| SMILES | CC=CC=C1C=C[N+](C)(C)C1=CC |
| InChI | InChI=1S/C12H18N/c1-5-7-8-11-9-10-13(3,4)12(11)6-2/h5-10H,1-4H3/q+1 |
| InChIKey | SQTCVRYGPZIIEP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|