C15H24 — CID 123452563
3-(1-cyclopropylethyl)-3,6-dimethylcyclooctyne (PubChem CID 123452563) has the molecular formula C15H24 and a molecular weight of 204.36 g/mol. Its IUPAC name is 3-(1-cyclopropylethyl)-3,6-dimethylcyclooctyne.
| Compound Name | 3-(1-cyclopropylethyl)-3,6-dimethylcyclooctyne |
|---|---|
| PubChem CID | 123452563 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | 3-(1-cyclopropylethyl)-3,6-dimethylcyclooctyne |
| SMILES | CC1CCC#CC(C)(C(C)C2CC2)CC1 |
| InChI | InChI=1S/C15H24/c1-12-6-4-5-10-15(3,11-9-12)13(2)14-7-8-14/h12-14H,4,6-9,11H2,1-3H3 |
| InChIKey | FMJBQQBCYPXLJS-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|