C20H26ClN3O2 — CID 123452577
4-[[4-[3-(4-chlorophenyl)pyrrolidine-1-carbonyl]piperidin-1-yl]methyl]azetidin-2-one (PubChem CID 123452577) has the molecular formula C20H26ClN3O2 and a molecular weight of 375.90 g/mol. Its IUPAC name is 4-[[4-[3-(4-chlorophenyl)pyrrolidine-1-carbonyl]piperidin-1-yl]methyl]azetidin-2-one.
| Compound Name | 4-[[4-[3-(4-chlorophenyl)pyrrolidine-1-carbonyl]piperidin-1-yl]methyl]azetidin-2-one |
|---|---|
| PubChem CID | 123452577 |
| Molecular Formula | C20H26ClN3O2 |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 4-[[4-[3-(4-chlorophenyl)pyrrolidine-1-carbonyl]piperidin-1-yl]methyl]azetidin-2-one |
| SMILES | O=C1CC(CN2CCC(C(=O)N3CCC(c4ccc(Cl)cc4)C3)CC2)N1 |
| InChI | InChI=1S/C20H26ClN3O2/c21-17-3-1-14(2-4-17)16-7-10-24(12-16)20(26)15-5-8-23(9-6-15)13-18-11-19(25)22-18/h1-4,15-16,18H,5-13H2,(H,22,25) |
| InChIKey | SWBJTSJYNJJOPU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |