About N-ethylidene-N'-methylmorpholine-4-carboximidamide
N-ethylidene-N'-methylmorpholine-4-carboximidamide (PubChem CID 123454942) has the molecular formula C8H15N3O
and a molecular weight of 169.23 g/mol. Its IUPAC name is N-ethylidene-N'-methylmorpholine-4-carboximidamide.
Molecular Properties
| Compound Name | N-ethylidene-N'-methylmorpholine-4-carboximidamide |
| PubChem CID | 123454942 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | N-ethylidene-N'-methylmorpholine-4-carboximidamide |
| SMILES | CC=N/C(=N\C)N1CCOCC1 |
| InChI | InChI=1S/C8H15N3O/c1-3-10-8(9-2)11-4-6-12-7-5-11/h3H,4-7H2,1-2H3/b9-8+,10-3? |
| InChIKey | SXUVILZJLSXOBT-KWESOJAUSA-N |
| XLogP | 0.40 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-ethylidene-N'-methylmorpholine-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylidene-N'-methylmorpholine-4-carboximidamide?
The IUPAC name of N-ethylidene-N'-methylmorpholine-4-carboximidamide (CID 123454942) is N-ethylidene-N'-methylmorpholine-4-carboximidamide.
What is the SMILES notation for N-ethylidene-N'-methylmorpholine-4-carboximidamide?
The canonical SMILES for N-ethylidene-N'-methylmorpholine-4-carboximidamide is CC=N/C(=N\C)N1CCOCC1.
What is the InChIKey of N-ethylidene-N'-methylmorpholine-4-carboximidamide?
The InChIKey is SXUVILZJLSXOBT-KWESOJAUSA-N. The full InChI is InChI=1S/C8H15N3O/c1-3-10-8(9-2)11-4-6-12-7-5-11/h3H,4-7H2,1-2H3/b9-8+,10-3?.
What are the key properties of N-ethylidene-N'-methylmorpholine-4-carboximidamide?
N-ethylidene-N'-methylmorpholine-4-carboximidamide has a molecular weight of 169.23 g/mol, XLogP of 0.40, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylidene-N'-methylmorpholine-4-carboximidamide is sourced from PubChem (CID 123454942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).