C52H26N4 — CID 123455074
2,5-bis(3-azahexacyclo[10.10.1.02,10.04,9.013,18.019,23]tricosa-1,4,6,8,10,12(23),13,15,17,19,21-undecaen-3-yl)-4-isocyanobenzonitrile (PubChem CID 123455074) has the molecular formula C52H26N4 and a molecular weight of 706.81 g/mol. Its IUPAC name is 2,5-bis(3-azahexacyclo[10.10.1.02,10.04,9.013,18.019,23]tricosa-1,4,6,8,10,12(23),13,15,17,19,21-undecaen-3-yl)-4-isocyanobenzonitrile.
| Compound Name | 2,5-bis(3-azahexacyclo[10.10.1.02,10.04,9.013,18.019,23]tricosa-1,4,6,8,10,12(23),13,15,17,19,21-undecaen-3-yl)-4-isocyanobenzonitrile |
|---|---|
| PubChem CID | 123455074 |
| Molecular Formula | C52H26N4 |
| Molecular Weight | 706.81 g/mol |
| Exact Mass | 706.22 |
| IUPAC Name | 2,5-bis(3-azahexacyclo[10.10.1.02,10.04,9.013,18.019,23]tricosa-1,4,6,8,10,12(23),13,15,17,19,21-undecaen-3-yl)-4-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cc(-n2c3ccccc3c3cc4c5c(cccc5c32)-c2ccccc2-4)c(C#N)cc1-n1c2ccccc2c2cc3c4c(cccc4c21)-c1ccccc1-3 |
| InChI | InChI=1S/C52H26N4/c1-54-44-27-47(55-45-22-8-6-16-34(45)42-25-40-32-14-4-2-12-30(32)36-18-10-20-38(49(36)40)51(42)55)29(28-53)24-48(44)56-46-23-9-7-17-35(46)43-26-41-33-15-5-3-13-31(33)37-19-11-21-39(50(37)41)52(43)56/h2-27H |
| InChIKey | IHWDOBCNSXSFOF-UHFFFAOYSA-N |
| XLogP | 13.90 |
| TPSA | 38.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.81 |
| LogP ≤ 5 | 13.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|