C30H15N3 — CID 153462698
3-(3,5-diisocyanophenyl)-3-azahexacyclo[10.10.1.02,10.04,9.013,18.019,23]tricosa-1,4,6,8,10,12(23),13,15,17,19,21-undecaene (PubChem CID 153462698) has the molecular formula C30H15N3 and a molecular weight of 417.47 g/mol. Its IUPAC name is 3-(3,5-diisocyanophenyl)-3-azahexacyclo[10.10.1.02,10.04,9.013,18.019,23]tricosa-1,4,6,8,10,12(23),13,15,17,19,21-undecaene.
| Compound Name | 3-(3,5-diisocyanophenyl)-3-azahexacyclo[10.10.1.02,10.04,9.013,18.019,23]tricosa-1,4,6,8,10,12(23),13,15,17,19,21-undecaene |
|---|---|
| PubChem CID | 153462698 |
| Molecular Formula | C30H15N3 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 3-(3,5-diisocyanophenyl)-3-azahexacyclo[10.10.1.02,10.04,9.013,18.019,23]tricosa-1,4,6,8,10,12(23),13,15,17,19,21-undecaene |
| SMILES | [C-]#[N+]c1cc([N+]#[C-])cc(-n2c3ccccc3c3cc4c5c(cccc5c32)-c2ccccc2-4)c1 |
| InChI | InChI=1S/C30H15N3/c1-31-18-14-19(32-2)16-20(15-18)33-28-13-6-5-10-23(28)27-17-26-22-9-4-3-8-21(22)24-11-7-12-25(29(24)26)30(27)33/h3-17H |
| InChIKey | ADQPBURCWUDDNT-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 13.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|