C19H42N4O4 — CID 123455408
2,2-dimethyl-3-[4,7,10-tris(2-hydroxyethyl)-1,4,7,10-tetrazacyclododec-1-yl]propan-1-ol (PubChem CID 123455408) has the molecular formula C19H42N4O4 and a molecular weight of 390.57 g/mol. Its IUPAC name is 2,2-dimethyl-3-[4,7,10-tris(2-hydroxyethyl)-1,4,7,10-tetrazacyclododec-1-yl]propan-1-ol.
| Compound Name | 2,2-dimethyl-3-[4,7,10-tris(2-hydroxyethyl)-1,4,7,10-tetrazacyclododec-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 123455408 |
| Molecular Formula | C19H42N4O4 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.32 |
| IUPAC Name | 2,2-dimethyl-3-[4,7,10-tris(2-hydroxyethyl)-1,4,7,10-tetrazacyclododec-1-yl]propan-1-ol |
| SMILES | CC(C)(CO)CN1CCN(CCO)CCN(CCO)CCN(CCO)CC1 |
| InChI | InChI=1S/C19H42N4O4/c1-19(2,18-27)17-23-9-7-21(12-15-25)5-3-20(11-14-24)4-6-22(8-10-23)13-16-26/h24-27H,3-18H2,1-2H3 |
| InChIKey | RSVODOHTNACGMB-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 93.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |