C23H17ClF2N4 — CID 123455575
1-[3-(4-chloro-1-methylindazol-7-yl)-6-ethynyl-2-pyridinyl]-2-(3,5-difluorophenyl)ethanamine (PubChem CID 123455575) has the molecular formula C23H17ClF2N4 and a molecular weight of 422.87 g/mol. Its IUPAC name is 1-[3-(4-chloro-1-methylindazol-7-yl)-6-ethynyl-2-pyridinyl]-2-(3,5-difluorophenyl)ethanamine.
| Compound Name | 1-[3-(4-chloro-1-methylindazol-7-yl)-6-ethynyl-2-pyridinyl]-2-(3,5-difluorophenyl)ethanamine |
|---|---|
| PubChem CID | 123455575 |
| Molecular Formula | C23H17ClF2N4 |
| Molecular Weight | 422.87 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 1-[3-(4-chloro-1-methylindazol-7-yl)-6-ethynyl-2-pyridinyl]-2-(3,5-difluorophenyl)ethanamine |
| SMILES | C#Cc1ccc(-c2ccc(Cl)c3cnn(C)c23)c(C(N)Cc2cc(F)cc(F)c2)n1 |
| InChI | InChI=1S/C23H17ClF2N4/c1-3-16-4-5-17(18-6-7-20(24)19-12-28-30(2)23(18)19)22(29-16)21(27)10-13-8-14(25)11-15(26)9-13/h1,4-9,11-12,21H,10,27H2,2H3 |
| InChIKey | JCBVBSOTRWGNRJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.87 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|