C24H17ClF2N4O2 — CID 90376100
[1-[3-(4-chloro-1-methylindazol-7-yl)-6-ethynyl-2-pyridinyl]-2-(3,5-difluorophenyl)ethyl]carbamic acid (PubChem CID 90376100) has the molecular formula C24H17ClF2N4O2 and a molecular weight of 466.88 g/mol. Its IUPAC name is [1-[3-(4-chloro-1-methylindazol-7-yl)-6-ethynyl-2-pyridinyl]-2-(3,5-difluorophenyl)ethyl]carbamic acid.
| Compound Name | [1-[3-(4-chloro-1-methylindazol-7-yl)-6-ethynyl-2-pyridinyl]-2-(3,5-difluorophenyl)ethyl]carbamic acid |
|---|---|
| PubChem CID | 90376100 |
| Molecular Formula | C24H17ClF2N4O2 |
| Molecular Weight | 466.88 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | [1-[3-(4-chloro-1-methylindazol-7-yl)-6-ethynyl-2-pyridinyl]-2-(3,5-difluorophenyl)ethyl]carbamic acid |
| SMILES | C#Cc1ccc(-c2ccc(Cl)c3cnn(C)c23)c(C(Cc2cc(F)cc(F)c2)NC(=O)O)n1 |
| InChI | InChI=1S/C24H17ClF2N4O2/c1-3-16-4-5-17(18-6-7-20(25)19-12-28-31(2)23(18)19)22(29-16)21(30-24(32)33)10-13-8-14(26)11-15(27)9-13/h1,4-9,11-12,21,30H,10H2,2H3,(H,32,33) |
| InChIKey | YWEUCVMUCZFZNQ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.88 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|