C16H24N4 — CID 123455975
N-methyl-1-[4-methyl-3-[2-(methylideneamino)penta-2,4-dienyl]-2H-imidazol-1-yl]pent-3-en-2-imine (PubChem CID 123455975) has the molecular formula C16H24N4 and a molecular weight of 272.40 g/mol. Its IUPAC name is N-methyl-1-[4-methyl-3-[2-(methylideneamino)penta-2,4-dienyl]-2H-imidazol-1-yl]pent-3-en-2-imine.
| Compound Name | N-methyl-1-[4-methyl-3-[2-(methylideneamino)penta-2,4-dienyl]-2H-imidazol-1-yl]pent-3-en-2-imine |
|---|---|
| PubChem CID | 123455975 |
| Molecular Formula | C16H24N4 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | N-methyl-1-[4-methyl-3-[2-(methylideneamino)penta-2,4-dienyl]-2H-imidazol-1-yl]pent-3-en-2-imine |
| SMILES | C=CC=C(CN1CN(C/C(C=CC)=N/C)C=C1C)N=C |
| InChI | InChI=1S/C16H24N4/c1-6-8-15(17-4)11-19-10-14(3)20(13-19)12-16(18-5)9-7-2/h6-10H,2,5,11-13H2,1,3-4H3/b8-6?,16-9?,17-15+ |
| InChIKey | QDOCEIGKNLRPDY-FDVFYOJOSA-N |
| XLogP | 2.84 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|