C25H42N6 — CID 142140542
(1Z,14Z)-7-[(1Z)-buta-1,3-dienyl]-3-ethenyl-5,13-diethyl-11-methyl-3,5,8,11,13,18-hexazabicyclo[13.2.1]octadeca-1,7,14,16-tetraene;ethane (PubChem CID 142140542) has the molecular formula C25H42N6 and a molecular weight of 426.65 g/mol. Its IUPAC name is (1Z,14Z)-7-[(1Z)-buta-1,3-dienyl]-3-ethenyl-5,13-diethyl-11-methyl-3,5,8,11,13,18-hexazabicyclo[13.2.1]octadeca-1,7,14,16-tetraene;ethane.
| Compound Name | (1Z,14Z)-7-[(1Z)-buta-1,3-dienyl]-3-ethenyl-5,13-diethyl-11-methyl-3,5,8,11,13,18-hexazabicyclo[13.2.1]octadeca-1,7,14,16-tetraene;ethane |
|---|---|
| PubChem CID | 142140542 |
| Molecular Formula | C25H42N6 |
| Molecular Weight | 426.65 g/mol |
| Exact Mass | 426.35 |
| IUPAC Name | (1Z,14Z)-7-[(1Z)-buta-1,3-dienyl]-3-ethenyl-5,13-diethyl-11-methyl-3,5,8,11,13,18-hexazabicyclo[13.2.1]octadeca-1,7,14,16-tetraene;ethane |
| SMILES | C=C/C=C\C1=N\CCN(C)CN(CC)/C=c2\cc/c([nH]2)=C\N(C=C)CN(CC)C1.CC |
| InChI | InChI=1S/C23H36N6.C2H6/c1-6-10-11-21-16-28(8-3)20-29(9-4)18-23-13-12-22(25-23)17-27(7-2)19-26(5)15-14-24-21;1-2/h6,9-13,17-18,25H,1,4,7-8,14-16,19-20H2,2-3,5H3;1-2H3/b11-10-,22-17+,23-18+,24-21-; |
| InChIKey | IOMUFSAHYYDXGN-CVVMVVRGSA-N |
| XLogP | 2.65 |
| TPSA | 41.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.65 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|