C18H18N6 — CID 85054384
1,3,6,18,22,23-hexazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-4,7,9,11,13(22),14,16,19-octaene (PubChem CID 85054384) has the molecular formula C18H18N6 and a molecular weight of 318.38 g/mol. Its IUPAC name is 1,3,6,18,22,23-hexazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-4,7,9,11,13(22),14,16,19-octaene.
| Compound Name | 1,3,6,18,22,23-hexazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-4,7,9,11,13(22),14,16,19-octaene |
|---|---|
| PubChem CID | 85054384 |
| Molecular Formula | C18H18N6 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 1,3,6,18,22,23-hexazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-4,7,9,11,13(22),14,16,19-octaene |
| SMILES | C1=CC2=NC1=CN1C=CN(C1)CN1C=CN(C=c3ccc([nH]3)=C2)C1 |
| InChI | InChI=1S/C18H18N6/c1-3-17-10-21-5-7-23(12-21)14-24-8-6-22(13-24)11-18-4-2-16(20-18)9-15(1)19-17/h1-11,19H,12-14H2 |
| InChIKey | MBFUZUHFBVPMAL-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 41.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |