C23H18N6 — CID 10110202
12,15,25,26,28,29-hexazahexacyclo[20.2.1.12,5.17,10.112,15.117,20]nonacosa-1,3,5(29),6,8,10,13,16,18,20,22(25),23-dodecaene (PubChem CID 10110202) has the molecular formula C23H18N6 and a molecular weight of 378.44 g/mol. Its IUPAC name is 12,15,25,26,28,29-hexazahexacyclo[20.2.1.12,5.17,10.112,15.117,20]nonacosa-1,3,5(29),6,8,10,13,16,18,20,22(25),23-dodecaene.
| Compound Name | 12,15,25,26,28,29-hexazahexacyclo[20.2.1.12,5.17,10.112,15.117,20]nonacosa-1,3,5(29),6,8,10,13,16,18,20,22(25),23-dodecaene |
|---|---|
| PubChem CID | 10110202 |
| Molecular Formula | C23H18N6 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 12,15,25,26,28,29-hexazahexacyclo[20.2.1.12,5.17,10.112,15.117,20]nonacosa-1,3,5(29),6,8,10,13,16,18,20,22(25),23-dodecaene |
| SMILES | C1=C/C2=C3\C=CC(=N3)/C=c3/cc/c([nH]3)=C/N3C=CN(/C=c4/cc/c([nH]4)=C/C1=N2)C3 |
| InChI | InChI=1S/C23H18N6/c1-3-20-13-28-9-10-29(15-28)14-21-4-2-17(25-21)12-19-6-8-23(27-19)22-7-5-18(26-22)11-16(1)24-20/h1-14,24-25H,15H2/b16-11-,17-12-,20-13-,21-14-,23-22- |
| InChIKey | AYBCYBBKPKMCBX-NWRIUMFWSA-N |
| XLogP | 0.37 |
| TPSA | 62.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |