C22H19N7 — CID 10293199
7,10,17,20,25,27,29-heptazahexacyclo[20.2.1.12,5.17,10.112,15.117,20]nonacosa-1(25),2(29),3,5,8,11,13,15,18,21,23-undecaene (PubChem CID 10293199) has the molecular formula C22H19N7 and a molecular weight of 381.44 g/mol. Its IUPAC name is 7,10,17,20,25,27,29-heptazahexacyclo[20.2.1.12,5.17,10.112,15.117,20]nonacosa-1(25),2(29),3,5,8,11,13,15,18,21,23-undecaene.
| Compound Name | 7,10,17,20,25,27,29-heptazahexacyclo[20.2.1.12,5.17,10.112,15.117,20]nonacosa-1(25),2(29),3,5,8,11,13,15,18,21,23-undecaene |
|---|---|
| PubChem CID | 10293199 |
| Molecular Formula | C22H19N7 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 7,10,17,20,25,27,29-heptazahexacyclo[20.2.1.12,5.17,10.112,15.117,20]nonacosa-1(25),2(29),3,5,8,11,13,15,18,21,23-undecaene |
| SMILES | C1=C/C2=C/N3C=CN(/C=c4/cc/c([nH]4)=C/N4C=CN(/C=C5/C=CC(=N5)C1=N2)C4)C3 |
| InChI | InChI=1S/C22H19N7/c1-2-18-12-27-8-10-29(16-27)14-20-4-6-22(25-20)21-5-3-19(24-21)13-28-9-7-26(15-28)11-17(1)23-18/h1-14,23H,15-16H2/b17-11-,18-12-,19-13-,20-14- |
| InChIKey | PWYORATZRNAGQR-KJHWEIRZSA-N |
| XLogP | 1.30 |
| TPSA | 53.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |