C23H21N7 — CID 10200725
(2Z,6Z,12Z,16Z,21Z)-1,8,11,23,27,28,30-heptazahexacyclo[21.2.1.13,6.18,11.113,16.118,21]triaconta-2,4,6,9,12,14,16,18(27),19,21,24-undecaene (PubChem CID 10200725) has the molecular formula C23H21N7 and a molecular weight of 395.47 g/mol. Its IUPAC name is (2Z,6Z,12Z,16Z,21Z)-1,8,11,23,27,28,30-heptazahexacyclo[21.2.1.13,6.18,11.113,16.118,21]triaconta-2,4,6,9,12,14,16,18(27),19,21,24-undecaene.
| Compound Name | (2Z,6Z,12Z,16Z,21Z)-1,8,11,23,27,28,30-heptazahexacyclo[21.2.1.13,6.18,11.113,16.118,21]triaconta-2,4,6,9,12,14,16,18(27),19,21,24-undecaene |
|---|---|
| PubChem CID | 10200725 |
| Molecular Formula | C23H21N7 |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | (2Z,6Z,12Z,16Z,21Z)-1,8,11,23,27,28,30-heptazahexacyclo[21.2.1.13,6.18,11.113,16.118,21]triaconta-2,4,6,9,12,14,16,18(27),19,21,24-undecaene |
| SMILES | C1=C/C2=C/N3C=CN(/C=c4/cc/c([nH]4)=C/N4C=CN(/C=c5/cc/c([nH]5)=C/C1=N2)C4)C3 |
| InChI | InChI=1S/C23H21N7/c1-3-20-12-27-7-9-29(16-27)14-22-5-6-23(26-22)15-30-10-8-28(17-30)13-21-4-2-19(25-21)11-18(1)24-20/h1-15,24,26H,16-17H2/b18-11-,20-12-,21-13-,22-14-,23-15- |
| InChIKey | MBHOXNTZLPEHSX-SXQHEZECSA-N |
| XLogP | -0.00 |
| TPSA | 56.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |