C24H18N6 — CID 10178481
1,23,27,28,29,30-hexazahexacyclo[21.2.1.13,6.18,11.113,16.118,21]triaconta-2,4,6,8(29),9,11,13(28),14,16,18(27),19,21,24-tridecaene (PubChem CID 10178481) has the molecular formula C24H18N6 and a molecular weight of 390.45 g/mol. Its IUPAC name is 1,23,27,28,29,30-hexazahexacyclo[21.2.1.13,6.18,11.113,16.118,21]triaconta-2,4,6,8(29),9,11,13(28),14,16,18(27),19,21,24-tridecaene.
| Compound Name | 1,23,27,28,29,30-hexazahexacyclo[21.2.1.13,6.18,11.113,16.118,21]triaconta-2,4,6,8(29),9,11,13(28),14,16,18(27),19,21,24-tridecaene |
|---|---|
| PubChem CID | 10178481 |
| Molecular Formula | C24H18N6 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 1,23,27,28,29,30-hexazahexacyclo[21.2.1.13,6.18,11.113,16.118,21]triaconta-2,4,6,8(29),9,11,13(28),14,16,18(27),19,21,24-tridecaene |
| SMILES | C1=C/C2=C/C3=N/C(=C\N4C=CN(/C=c5/cc/c([nH]5)=C/C5=N/C(=C\C1=N2)C=C5)C4)C=C3 |
| InChI | InChI=1S/C24H18N6/c1-3-19-12-21-5-7-23(27-21)14-29-9-10-30(16-29)15-24-8-6-22(28-24)13-20-4-2-18(26-20)11-17(1)25-19/h1-15,27H,16H2/b17-11-,20-13-,21-12-,23-14-,24-15- |
| InChIKey | LWCCDBDJXTWIDF-YUUDRFKKSA-N |
| XLogP | 2.23 |
| TPSA | 59.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |