C28H24N8 — CID 10227218
1,13,16,28,32,33,35,36-octazaheptacyclo[26.2.1.13,6.18,11.113,16.118,21.123,26]hexatriaconta-2,4,6(36),7,9,11,14,17,19,21,23(32),24,26,29-tetradecaene (PubChem CID 10227218) has the molecular formula C28H24N8 and a molecular weight of 472.56 g/mol. Its IUPAC name is 1,13,16,28,32,33,35,36-octazaheptacyclo[26.2.1.13,6.18,11.113,16.118,21.123,26]hexatriaconta-2,4,6(36),7,9,11,14,17,19,21,23(32),24,26,29-tetradecaene.
| Compound Name | 1,13,16,28,32,33,35,36-octazaheptacyclo[26.2.1.13,6.18,11.113,16.118,21.123,26]hexatriaconta-2,4,6(36),7,9,11,14,17,19,21,23(32),24,26,29-tetradecaene |
|---|---|
| PubChem CID | 10227218 |
| Molecular Formula | C28H24N8 |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 1,13,16,28,32,33,35,36-octazaheptacyclo[26.2.1.13,6.18,11.113,16.118,21.123,26]hexatriaconta-2,4,6(36),7,9,11,14,17,19,21,23(32),24,26,29-tetradecaene |
| SMILES | C1=C/C2=C/N3C=CN(/C=C4/C=CC(=N4)/C=c4\cc/c([nH]4)=C\N4C=CN(/C=c5\cc/c([nH]5)=C/C1=N2)C4)C3 |
| InChI | InChI=1S/C28H24N8/c1-5-25-15-33-9-10-34(19-33)17-27-7-3-23(31-27)14-24-4-8-28(32-24)18-36-12-11-35(20-36)16-26-6-2-22(30-26)13-21(1)29-25/h1-18,29,31H,19-20H2/b21-13-,23-14+,25-15+,26-16-,27-17+,28-18- |
| InChIKey | ARMHOXKWNCNJHC-OTJBXYEKSA-N |
| XLogP | 0.89 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |