C26H22N8 — CID 20816054
7,10,21,24,29,31,32,34-octazaheptacyclo[24.2.1.12,5.17,10.112,15.116,19.121,24]tetratriaconta-1(29),2(34),3,5,8,11,13,15,17,19,22,25,27-tridecaene (PubChem CID 20816054) has the molecular formula C26H22N8 and a molecular weight of 446.52 g/mol. Its IUPAC name is 7,10,21,24,29,31,32,34-octazaheptacyclo[24.2.1.12,5.17,10.112,15.116,19.121,24]tetratriaconta-1(29),2(34),3,5,8,11,13,15,17,19,22,25,27-tridecaene.
| Compound Name | 7,10,21,24,29,31,32,34-octazaheptacyclo[24.2.1.12,5.17,10.112,15.116,19.121,24]tetratriaconta-1(29),2(34),3,5,8,11,13,15,17,19,22,25,27-tridecaene |
|---|---|
| PubChem CID | 20816054 |
| Molecular Formula | C26H22N8 |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 7,10,21,24,29,31,32,34-octazaheptacyclo[24.2.1.12,5.17,10.112,15.116,19.121,24]tetratriaconta-1(29),2(34),3,5,8,11,13,15,17,19,22,25,27-tridecaene |
| SMILES | C1=C/C2=C\N3C=CN(/C=c4/cc/c([nH]4)=c4/cc/c([nH]4)=C\N4C=CN(/C=C5\C=CC(=N5)C1=N2)C4)C3 |
| InChI | InChI=1S/C26H22N8/c1-5-23-24-6-2-20(28-24)14-33-11-12-34(18-33)16-22-4-8-26(30-22)25-7-3-21(29-25)15-32-10-9-31(17-32)13-19(1)27-23/h1-16,27-28H,17-18H2/b19-13-,20-14+,21-15+,22-16+,24-23+ |
| InChIKey | HWBAGQQVOYBEKW-DDJUQONYSA-N |
| XLogP | 1.92 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |