C22H16N4 — CID 162415039
23,24,25,26-tetrazapentacyclo[18.2.1.13,6.19,12.114,17]hexacosa-1(23),2,4,6,8,10,12(25),13,15,17,19,21-dodecaene (PubChem CID 162415039) has the molecular formula C22H16N4 and a molecular weight of 336.40 g/mol. Its IUPAC name is 23,24,25,26-tetrazapentacyclo[18.2.1.13,6.19,12.114,17]hexacosa-1(23),2,4,6,8,10,12(25),13,15,17,19,21-dodecaene.
| Compound Name | 23,24,25,26-tetrazapentacyclo[18.2.1.13,6.19,12.114,17]hexacosa-1(23),2,4,6,8,10,12(25),13,15,17,19,21-dodecaene |
|---|---|
| PubChem CID | 162415039 |
| Molecular Formula | C22H16N4 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 23,24,25,26-tetrazapentacyclo[18.2.1.13,6.19,12.114,17]hexacosa-1(23),2,4,6,8,10,12(25),13,15,17,19,21-dodecaene |
| SMILES | C1=C/C2=C\C=c3/cc/c([nH]3)=C\C3=N/C(=C/C=c4\cc/c([nH]4)=C\C1=N2)C=C3 |
| InChI | InChI=1S/C22H16N4/c1-2-16-6-10-20(24-16)14-22-12-8-18(26-22)4-3-17-7-11-21(25-17)13-19-9-5-15(1)23-19/h1-14,23,26H/b2-1-,4-3-,15-1-,16-2+,17-3-,18-4+,19-13-,20-14+,21-13-,22-14+ |
| InChIKey | OCGYGPVAPPYWTK-KEKMYVFSSA-N |
| XLogP | 0.97 |
| TPSA | 56.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |