C33H72N4 — CID 142562233
N,N'-dimethyl-N'-pentylethane-1,2-diamine;ethane;(3E,5Z)-N-[1-[(Z)-4-methylpent-3-en-2-ylideneamino]ethenyl]octa-3,5-dien-4-amine (PubChem CID 142562233) has the molecular formula C33H72N4 and a molecular weight of 524.97 g/mol. Its IUPAC name is N,N'-dimethyl-N'-pentylethane-1,2-diamine;ethane;(3E,5Z)-N-[1-[(Z)-4-methylpent-3-en-2-ylideneamino]ethenyl]octa-3,5-dien-4-amine.
| Compound Name | N,N'-dimethyl-N'-pentylethane-1,2-diamine;ethane;(3E,5Z)-N-[1-[(Z)-4-methylpent-3-en-2-ylideneamino]ethenyl]octa-3,5-dien-4-amine |
|---|---|
| PubChem CID | 142562233 |
| Molecular Formula | C33H72N4 |
| Molecular Weight | 524.97 g/mol |
| Exact Mass | 524.58 |
| IUPAC Name | N,N'-dimethyl-N'-pentylethane-1,2-diamine;ethane;(3E,5Z)-N-[1-[(Z)-4-methylpent-3-en-2-ylideneamino]ethenyl]octa-3,5-dien-4-amine |
| SMILES | C=C(/N=C(/C)C=C(C)C)NC(/C=C\CC)=C/CC.CC.CC.CC.CC.CCCCCN(C)CCNC |
| InChI | InChI=1S/C16H26N2.C9H22N2.4C2H6/c1-7-9-11-16(10-8-2)18-15(6)17-14(5)12-13(3)4;1-4-5-6-8-11(3)9-7-10-2;4*1-2/h9-12,18H,6-8H2,1-5H3;10H,4-9H2,1-3H3;4*1-2H3/b11-9-,16-10+,17-14-;;;;; |
| InChIKey | CUBOEJZOJSIXNO-CTSULWMQSA-N |
| XLogP | 10.17 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.97 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|