C28H50N6 — CID 143673684
(4E,6E,8Z,12Z)-18-N-[2-(dimethylamino)ethyl]-8-ethylidene-18-N-methyl-2,4,10-triazabicyclo[15.4.1]docosa-1(21),4,6,12,17(22),18-hexaene-3,18-diamine;ethane;molecular hydrogen (PubChem CID 143673684) has the molecular formula C28H50N6 and a molecular weight of 470.75 g/mol. Its IUPAC name is (4E,6E,8Z,12Z)-18-N-[2-(dimethylamino)ethyl]-8-ethylidene-18-N-methyl-2,4,10-triazabicyclo[15.4.1]docosa-1(21),4,6,12,17(22),18-hexaene-3,18-diamine;ethane;molecular hydrogen.
| Compound Name | (4E,6E,8Z,12Z)-18-N-[2-(dimethylamino)ethyl]-8-ethylidene-18-N-methyl-2,4,10-triazabicyclo[15.4.1]docosa-1(21),4,6,12,17(22),18-hexaene-3,18-diamine;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 143673684 |
| Molecular Formula | C28H50N6 |
| Molecular Weight | 470.75 g/mol |
| Exact Mass | 470.41 |
| IUPAC Name | (4E,6E,8Z,12Z)-18-N-[2-(dimethylamino)ethyl]-8-ethylidene-18-N-methyl-2,4,10-triazabicyclo[15.4.1]docosa-1(21),4,6,12,17(22),18-hexaene-3,18-diamine;ethane;molecular hydrogen |
| SMILES | C/C=C1/C=C\C=N\C(N)NC2=CCC=C(N(C)CCN(C)C)C(=C2)CCC/C=C/CNC1.CC.[H][H] |
| InChI | InChI=1S/C26H42N6.C2H6.H2/c1-5-22-12-11-17-29-26(27)30-24-14-10-15-25(32(4)19-18-31(2)3)23(20-24)13-8-6-7-9-16-28-21-22;1-2;/h5,7,9,11-12,14-15,17,20,26,28,30H,6,8,10,13,16,18-19,21,27H2,1-4H3;1-2H3;1H/b9-7+,12-11-,22-5-,29-17+;; |
| InChIKey | KTTYGLADPAVYQL-MWSFGALBSA-N |
| XLogP | 4.58 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.75 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|