C28H49N3 — CID 143682774
3-butylcyclohepta-1,3,5-triene;ethane;4-N-ethyl-4-N-[(3Z)-3-(ethylideneamino)penta-1,3-dien-2-yl]cyclohexane-1,4-diamine (PubChem CID 143682774) has the molecular formula C28H49N3 and a molecular weight of 427.72 g/mol. Its IUPAC name is 3-butylcyclohepta-1,3,5-triene;ethane;4-N-ethyl-4-N-[(3Z)-3-(ethylideneamino)penta-1,3-dien-2-yl]cyclohexane-1,4-diamine.
| Compound Name | 3-butylcyclohepta-1,3,5-triene;ethane;4-N-ethyl-4-N-[(3Z)-3-(ethylideneamino)penta-1,3-dien-2-yl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 143682774 |
| Molecular Formula | C28H49N3 |
| Molecular Weight | 427.72 g/mol |
| Exact Mass | 427.39 |
| IUPAC Name | 3-butylcyclohepta-1,3,5-triene;ethane;4-N-ethyl-4-N-[(3Z)-3-(ethylideneamino)penta-1,3-dien-2-yl]cyclohexane-1,4-diamine |
| SMILES | C=C(C(=C/C)/N=C/C)N(CC)C1CCC(N)CC1.CC.CCCCC1=CC=CCC=C1 |
| InChI | InChI=1S/C15H27N3.C11H16.C2H6/c1-5-15(17-6-2)12(4)18(7-3)14-10-8-13(16)9-11-14;1-2-3-8-11-9-6-4-5-7-10-11;1-2/h5-6,13-14H,4,7-11,16H2,1-3H3;4,6-7,9-10H,2-3,5,8H2,1H3;1-2H3/b15-5-,17-6+;; |
| InChIKey | GKPUASZELNXTQN-DWGYTMNFSA-N |
| XLogP | 7.73 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.72 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|