C26H42N6 — CID 143673685
(4E,6E,8Z,12Z)-18-N-[2-(dimethylamino)ethyl]-8-ethylidene-18-N-methyl-2,4,10-triazabicyclo[15.4.1]docosa-1(21),4,6,12,17(22),18-hexaene-3,18-diamine (PubChem CID 143673685) has the molecular formula C26H42N6 and a molecular weight of 438.66 g/mol. Its IUPAC name is (4E,6E,8Z,12Z)-18-N-[2-(dimethylamino)ethyl]-8-ethylidene-18-N-methyl-2,4,10-triazabicyclo[15.4.1]docosa-1(21),4,6,12,17(22),18-hexaene-3,18-diamine.
| Compound Name | (4E,6E,8Z,12Z)-18-N-[2-(dimethylamino)ethyl]-8-ethylidene-18-N-methyl-2,4,10-triazabicyclo[15.4.1]docosa-1(21),4,6,12,17(22),18-hexaene-3,18-diamine |
|---|---|
| PubChem CID | 143673685 |
| Molecular Formula | C26H42N6 |
| Molecular Weight | 438.66 g/mol |
| Exact Mass | 438.35 |
| IUPAC Name | (4E,6E,8Z,12Z)-18-N-[2-(dimethylamino)ethyl]-8-ethylidene-18-N-methyl-2,4,10-triazabicyclo[15.4.1]docosa-1(21),4,6,12,17(22),18-hexaene-3,18-diamine |
| SMILES | C/C=C1/C=C\C=N\C(N)NC2=CCC=C(N(C)CCN(C)C)C(=C2)CCC/C=C/CNC1 |
| InChI | InChI=1S/C26H42N6/c1-5-22-12-11-17-29-26(27)30-24-14-10-15-25(32(4)19-18-31(2)3)23(20-24)13-8-6-7-9-16-28-21-22/h5,7,9,11-12,14-15,17,20,26,28,30H,6,8,10,13,16,18-19,21,27H2,1-4H3/b9-7+,12-11-,22-5-,29-17+ |
| InChIKey | WKRGHPFXZMNVGL-DPIUXWGFSA-N |
| XLogP | 3.31 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.66 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|