C30H50ClN5 — CID 143347107
N-chloroprop-1-en-2-amine;N,N-dimethylmethanamine;6-[2-[[(5Z)-6-(ethylideneamino)-3-methylidenehepta-1,5-dien-2-yl]amino]ethyl]-N,N-dimethyl-2-prop-2-enylcyclohepta-1,4,6-trien-1-amine (PubChem CID 143347107) has the molecular formula C30H50ClN5 and a molecular weight of 516.22 g/mol. Its IUPAC name is N-chloroprop-1-en-2-amine;N,N-dimethylmethanamine;6-[2-[[(5Z)-6-(ethylideneamino)-3-methylidenehepta-1,5-dien-2-yl]amino]ethyl]-N,N-dimethyl-2-prop-2-enylcyclohepta-1,4,6-trien-1-amine.
| Compound Name | N-chloroprop-1-en-2-amine;N,N-dimethylmethanamine;6-[2-[[(5Z)-6-(ethylideneamino)-3-methylidenehepta-1,5-dien-2-yl]amino]ethyl]-N,N-dimethyl-2-prop-2-enylcyclohepta-1,4,6-trien-1-amine |
|---|---|
| PubChem CID | 143347107 |
| Molecular Formula | C30H50ClN5 |
| Molecular Weight | 516.22 g/mol |
| Exact Mass | 515.38 |
| IUPAC Name | N-chloroprop-1-en-2-amine;N,N-dimethylmethanamine;6-[2-[[(5Z)-6-(ethylideneamino)-3-methylidenehepta-1,5-dien-2-yl]amino]ethyl]-N,N-dimethyl-2-prop-2-enylcyclohepta-1,4,6-trien-1-amine |
| SMILES | C=C(C)NCl.C=CCC1=C(N(C)C)C=C(CCNC(=C)C(=C)C/C=C(C)\N=C\C)C=CC1.CN(C)C |
| InChI | InChI=1S/C24H35N3.C3H6ClN.C3H9N/c1-8-11-23-13-10-12-22(18-24(23)27(6)7)16-17-26-21(5)19(3)14-15-20(4)25-9-2;1-3(2)5-4;1-4(2)3/h8-10,12,15,18,26H,1,3,5,11,13-14,16-17H2,2,4,6-7H3;5H,1H2,2H3;1-3H3/b20-15-,25-9+;; |
| InChIKey | XBNVSDZIJCALDO-BDZLZXEJSA-N |
| XLogP | 7.14 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.22 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|