C20H30N2 — CID 142901966
(3E,4Z,7Z)-N-but-1-en-2-yl-5-ethenyl-3-ethylidene-7-[(ethylideneamino)methylidene]nona-4,8-dien-2-amine (PubChem CID 142901966) has the molecular formula C20H30N2 and a molecular weight of 298.47 g/mol. Its IUPAC name is (3E,4Z,7Z)-N-but-1-en-2-yl-5-ethenyl-3-ethylidene-7-[(ethylideneamino)methylidene]nona-4,8-dien-2-amine.
| Compound Name | (3E,4Z,7Z)-N-but-1-en-2-yl-5-ethenyl-3-ethylidene-7-[(ethylideneamino)methylidene]nona-4,8-dien-2-amine |
|---|---|
| PubChem CID | 142901966 |
| Molecular Formula | C20H30N2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | (3E,4Z,7Z)-N-but-1-en-2-yl-5-ethenyl-3-ethylidene-7-[(ethylideneamino)methylidene]nona-4,8-dien-2-amine |
| SMILES | C=C/C(=C\N=C\C)C/C(C=C)=C/C(=C\C)C(C)NC(=C)CC |
| InChI | InChI=1S/C20H30N2/c1-8-16(6)22-17(7)20(11-4)14-18(9-2)13-19(10-3)15-21-12-5/h9-12,14-15,17,22H,2-3,6,8,13H2,1,4-5,7H3/b18-14+,19-15+,20-11+,21-12+ |
| InChIKey | KFWINGZKLLWMRN-RVFQMQHOSA-N |
| XLogP | 5.50 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|