C23H32FN3 — CID 143343651
(4Z,7E)-4-ethyl-5-(ethylideneamino)-2-N-[(4-fluoro-3-methylcyclohepta-1,3,5-trien-1-yl)methyl]-3-methylidenenona-1,4,7-triene-2,7-diamine (PubChem CID 143343651) has the molecular formula C23H32FN3 and a molecular weight of 369.53 g/mol. Its IUPAC name is (4Z,7E)-4-ethyl-5-(ethylideneamino)-2-N-[(4-fluoro-3-methylcyclohepta-1,3,5-trien-1-yl)methyl]-3-methylidenenona-1,4,7-triene-2,7-diamine.
| Compound Name | (4Z,7E)-4-ethyl-5-(ethylideneamino)-2-N-[(4-fluoro-3-methylcyclohepta-1,3,5-trien-1-yl)methyl]-3-methylidenenona-1,4,7-triene-2,7-diamine |
|---|---|
| PubChem CID | 143343651 |
| Molecular Formula | C23H32FN3 |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.26 |
| IUPAC Name | (4Z,7E)-4-ethyl-5-(ethylideneamino)-2-N-[(4-fluoro-3-methylcyclohepta-1,3,5-trien-1-yl)methyl]-3-methylidenenona-1,4,7-triene-2,7-diamine |
| SMILES | C=C(NCC1=CC(C)=C(F)C=CC1)C(=C)/C(CC)=C(C/C(N)=C\C)\N=C\C |
| InChI | InChI=1S/C23H32FN3/c1-7-20(25)14-23(26-9-3)21(8-2)17(5)18(6)27-15-19-11-10-12-22(24)16(4)13-19/h7,9-10,12-13,27H,5-6,8,11,14-15,25H2,1-4H3/b20-7+,23-21-,26-9+ |
| InChIKey | WOBUZGLODRCFCR-RXNRVCJNSA-N |
| XLogP | 5.78 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|