C21H37N3 — CID 142013442
1-N,1-N-diethyl-4-N-[(2E,3Z)-3-ethylidene-2-propylidene-4-pyridinyl]pentane-1,4-diamine;ethene (PubChem CID 142013442) has the molecular formula C21H37N3 and a molecular weight of 331.55 g/mol. Its IUPAC name is 1-N,1-N-diethyl-4-N-[(2E,3Z)-3-ethylidene-2-propylidene-4-pyridinyl]pentane-1,4-diamine;ethene.
| Compound Name | 1-N,1-N-diethyl-4-N-[(2E,3Z)-3-ethylidene-2-propylidene-4-pyridinyl]pentane-1,4-diamine;ethene |
|---|---|
| PubChem CID | 142013442 |
| Molecular Formula | C21H37N3 |
| Molecular Weight | 331.55 g/mol |
| Exact Mass | 331.30 |
| IUPAC Name | 1-N,1-N-diethyl-4-N-[(2E,3Z)-3-ethylidene-2-propylidene-4-pyridinyl]pentane-1,4-diamine;ethene |
| SMILES | C/C=c1/c(NC(C)CCCN(CC)CC)ccn/c1=C/CC.C=C |
| InChI | InChI=1S/C19H33N3.C2H4/c1-6-11-18-17(7-2)19(13-14-20-18)21-16(5)12-10-15-22(8-3)9-4;1-2/h7,11,13-14,16,21H,6,8-10,12,15H2,1-5H3;1-2H2/b17-7+,18-11+; |
| InChIKey | GARJIXPVRFWYIH-CHXWSSTISA-N |
| XLogP | 3.80 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.55 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|