C22H33F2N3 — CID 143346416
(1E,4Z)-4-N-[(E)-5,5-difluoro-4-methylidene-2-[(Z)-prop-1-enyl]hex-2-enyl]-1-(ethylideneamino)-2-N,2-N-dimethyl-3-methylidenehepta-1,4-diene-2,4-diamine (PubChem CID 143346416) has the molecular formula C22H33F2N3 and a molecular weight of 377.52 g/mol. Its IUPAC name is (1E,4Z)-4-N-[(E)-5,5-difluoro-4-methylidene-2-[(Z)-prop-1-enyl]hex-2-enyl]-1-(ethylideneamino)-2-N,2-N-dimethyl-3-methylidenehepta-1,4-diene-2,4-diamine.
| Compound Name | (1E,4Z)-4-N-[(E)-5,5-difluoro-4-methylidene-2-[(Z)-prop-1-enyl]hex-2-enyl]-1-(ethylideneamino)-2-N,2-N-dimethyl-3-methylidenehepta-1,4-diene-2,4-diamine |
|---|---|
| PubChem CID | 143346416 |
| Molecular Formula | C22H33F2N3 |
| Molecular Weight | 377.52 g/mol |
| Exact Mass | 377.26 |
| IUPAC Name | (1E,4Z)-4-N-[(E)-5,5-difluoro-4-methylidene-2-[(Z)-prop-1-enyl]hex-2-enyl]-1-(ethylideneamino)-2-N,2-N-dimethyl-3-methylidenehepta-1,4-diene-2,4-diamine |
| SMILES | C=C(/C(=C/CC)NCC(/C=C\C)=C/C(=C)C(C)(F)F)/C(=C\N=C\C)N(C)C |
| InChI | InChI=1S/C22H33F2N3/c1-9-12-19(14-17(4)22(6,23)24)15-26-20(13-10-2)18(5)21(27(7)8)16-25-11-3/h9,11-14,16,26H,4-5,10,15H2,1-3,6-8H3/b12-9-,19-14+,20-13-,21-16+,25-11+ |
| InChIKey | ZTRHTNFTQJLOPK-WQCAFRGWSA-N |
| XLogP | 5.63 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.52 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|