C24H35F3N4 — CID 143343934
(2E,4E,5Z)-3-N-[(E)-2-aminoethenyl]-4-ethylidene-2-(ethylideneamino)-3-N-methyl-5-N-[(2E)-2-[(Z)-prop-1-enyl]-4-(trifluoromethyl)penta-2,4-dienyl]octa-2,5-diene-3,5-diamine (PubChem CID 143343934) has the molecular formula C24H35F3N4 and a molecular weight of 436.57 g/mol. Its IUPAC name is (2E,4E,5Z)-3-N-[(E)-2-aminoethenyl]-4-ethylidene-2-(ethylideneamino)-3-N-methyl-5-N-[(2E)-2-[(Z)-prop-1-enyl]-4-(trifluoromethyl)penta-2,4-dienyl]octa-2,5-diene-3,5-diamine.
| Compound Name | (2E,4E,5Z)-3-N-[(E)-2-aminoethenyl]-4-ethylidene-2-(ethylideneamino)-3-N-methyl-5-N-[(2E)-2-[(Z)-prop-1-enyl]-4-(trifluoromethyl)penta-2,4-dienyl]octa-2,5-diene-3,5-diamine |
|---|---|
| PubChem CID | 143343934 |
| Molecular Formula | C24H35F3N4 |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | (2E,4E,5Z)-3-N-[(E)-2-aminoethenyl]-4-ethylidene-2-(ethylideneamino)-3-N-methyl-5-N-[(2E)-2-[(Z)-prop-1-enyl]-4-(trifluoromethyl)penta-2,4-dienyl]octa-2,5-diene-3,5-diamine |
| SMILES | C=C(/C=C(\C=C/C)CNC(=C\CC)/C(=C\C)C(=C(C)\N=C\C)/N(C)/C=C/N)C(F)(F)F |
| InChI | InChI=1S/C24H35F3N4/c1-8-12-20(16-18(5)24(25,26)27)17-30-22(13-9-2)21(10-3)23(19(6)29-11-4)31(7)15-14-28/h8,10-16,30H,5,9,17,28H2,1-4,6-7H3/b12-8-,15-14+,20-16+,21-10+,22-13-,23-19+,29-11+ |
| InChIKey | PPXCFSNRFZRMGP-DEHVTHTPSA-N |
| XLogP | 6.12 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|