C12H18F2N2 — CID 154643434
N-[3-butyl-6-(difluoromethyl)-1,2-dihydropyridin-4-yl]ethanimine (PubChem CID 154643434) has the molecular formula C12H18F2N2 and a molecular weight of 228.29 g/mol. Its IUPAC name is N-[3-butyl-6-(difluoromethyl)-1,2-dihydropyridin-4-yl]ethanimine.
| Compound Name | N-[3-butyl-6-(difluoromethyl)-1,2-dihydropyridin-4-yl]ethanimine |
|---|---|
| PubChem CID | 154643434 |
| Molecular Formula | C12H18F2N2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | N-[3-butyl-6-(difluoromethyl)-1,2-dihydropyridin-4-yl]ethanimine |
| SMILES | C/C=N/C1=C(CCCC)CNC(C(F)F)=C1 |
| InChI | InChI=1S/C12H18F2N2/c1-3-5-6-9-8-16-11(12(13)14)7-10(9)15-4-2/h4,7,12,16H,3,5-6,8H2,1-2H3/b15-4+ |
| InChIKey | TWOULOCKQWZHLT-SYZQJQIISA-N |
| XLogP | 3.27 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|