C25H41N3 — CID 162682981
5-[(2S)-butan-2-yl]-6-(ethylideneamino)-N-methylcyclohepta-1,3,5-trien-1-amine;(3Z,5Z)-N,N,5-trimethyl-2-methylidenehepta-3,5-dien-1-amine (PubChem CID 162682981) has the molecular formula C25H41N3 and a molecular weight of 383.62 g/mol. Its IUPAC name is 5-[(2S)-butan-2-yl]-6-(ethylideneamino)-N-methylcyclohepta-1,3,5-trien-1-amine;(3Z,5Z)-N,N,5-trimethyl-2-methylidenehepta-3,5-dien-1-amine.
| Compound Name | 5-[(2S)-butan-2-yl]-6-(ethylideneamino)-N-methylcyclohepta-1,3,5-trien-1-amine;(3Z,5Z)-N,N,5-trimethyl-2-methylidenehepta-3,5-dien-1-amine |
|---|---|
| PubChem CID | 162682981 |
| Molecular Formula | C25H41N3 |
| Molecular Weight | 383.62 g/mol |
| Exact Mass | 383.33 |
| IUPAC Name | 5-[(2S)-butan-2-yl]-6-(ethylideneamino)-N-methylcyclohepta-1,3,5-trien-1-amine;(3Z,5Z)-N,N,5-trimethyl-2-methylidenehepta-3,5-dien-1-amine |
| SMILES | C/C=N/C1=C([C@@H](C)CC)C=CC=C(NC)C1.C=C(/C=C\C(C)=C/C)CN(C)C |
| InChI | InChI=1S/C14H22N2.C11H19N/c1-5-11(3)13-9-7-8-12(15-4)10-14(13)16-6-2;1-6-10(2)7-8-11(3)9-12(4)5/h6-9,11,15H,5,10H2,1-4H3;6-8H,3,9H2,1-2,4-5H3/b16-6+;8-7-,10-6-/t11-;/m0./s1 |
| InChIKey | BQRVMOWMAPNBQR-SQQDLRNXSA-N |
| XLogP | 6.07 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.62 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|