C27H43N3 — CID 176931790
(4Z,6E,9Z,10E)-3,6-diethyl-9-ethylidene-4-[3-(1,2,3,6-tetrahydropyridin-5-yl)but-3-enylideneamino]dodeca-4,6,10-trien-1-amine (PubChem CID 176931790) has the molecular formula C27H43N3 and a molecular weight of 409.66 g/mol. Its IUPAC name is (4Z,6E,9Z,10E)-3,6-diethyl-9-ethylidene-4-[3-(1,2,3,6-tetrahydropyridin-5-yl)but-3-enylideneamino]dodeca-4,6,10-trien-1-amine.
| Compound Name | (4Z,6E,9Z,10E)-3,6-diethyl-9-ethylidene-4-[3-(1,2,3,6-tetrahydropyridin-5-yl)but-3-enylideneamino]dodeca-4,6,10-trien-1-amine |
|---|---|
| PubChem CID | 176931790 |
| Molecular Formula | C27H43N3 |
| Molecular Weight | 409.66 g/mol |
| Exact Mass | 409.35 |
| IUPAC Name | (4Z,6E,9Z,10E)-3,6-diethyl-9-ethylidene-4-[3-(1,2,3,6-tetrahydropyridin-5-yl)but-3-enylideneamino]dodeca-4,6,10-trien-1-amine |
| SMILES | C=C(C/C=N/C(=C\C(=C\CC(=C/C)/C=C/C)CC)C(CC)CCN)C1=CCCNC1 |
| InChI | InChI=1S/C27H43N3/c1-6-11-23(7-2)13-14-24(8-3)20-27(25(9-4)15-17-28)30-19-16-22(5)26-12-10-18-29-21-26/h6-7,11-12,14,19-20,25,29H,5,8-10,13,15-18,21,28H2,1-4H3/b11-6+,23-7+,24-14+,27-20-,30-19+ |
| InChIKey | MVHTXKKLKWZUKE-OBIXFREYSA-N |
| XLogP | 6.43 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.66 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|