C24H35N3 — CID 143347109
6-[2-[[(5Z)-6-(ethylideneamino)-3-methylidenehepta-1,5-dien-2-yl]amino]ethyl]-N,N-dimethyl-2-prop-2-enylcyclohepta-1,4,6-trien-1-amine (PubChem CID 143347109) has the molecular formula C24H35N3 and a molecular weight of 365.57 g/mol. Its IUPAC name is 6-[2-[[(5Z)-6-(ethylideneamino)-3-methylidenehepta-1,5-dien-2-yl]amino]ethyl]-N,N-dimethyl-2-prop-2-enylcyclohepta-1,4,6-trien-1-amine.
| Compound Name | 6-[2-[[(5Z)-6-(ethylideneamino)-3-methylidenehepta-1,5-dien-2-yl]amino]ethyl]-N,N-dimethyl-2-prop-2-enylcyclohepta-1,4,6-trien-1-amine |
|---|---|
| PubChem CID | 143347109 |
| Molecular Formula | C24H35N3 |
| Molecular Weight | 365.57 g/mol |
| Exact Mass | 365.28 |
| IUPAC Name | 6-[2-[[(5Z)-6-(ethylideneamino)-3-methylidenehepta-1,5-dien-2-yl]amino]ethyl]-N,N-dimethyl-2-prop-2-enylcyclohepta-1,4,6-trien-1-amine |
| SMILES | C=CCC1=C(N(C)C)C=C(CCNC(=C)C(=C)C/C=C(C)\N=C\C)C=CC1 |
| InChI | InChI=1S/C24H35N3/c1-8-11-23-13-10-12-22(18-24(23)27(6)7)16-17-26-21(5)19(3)14-15-20(4)25-9-2/h8-10,12,15,18,26H,1,3,5,11,13-14,16-17H2,2,4,6-7H3/b20-15-,25-9+ |
| InChIKey | KWKDXGGPWYVUJO-LICOBOKKSA-N |
| XLogP | 5.70 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.57 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|