C14H22N2 — CID 162682983
5-[(2S)-butan-2-yl]-6-(ethylideneamino)-N-methylcyclohepta-1,3,5-trien-1-amine (PubChem CID 162682983) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 5-[(2S)-butan-2-yl]-6-(ethylideneamino)-N-methylcyclohepta-1,3,5-trien-1-amine.
| Compound Name | 5-[(2S)-butan-2-yl]-6-(ethylideneamino)-N-methylcyclohepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 162682983 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 5-[(2S)-butan-2-yl]-6-(ethylideneamino)-N-methylcyclohepta-1,3,5-trien-1-amine |
| SMILES | C/C=N/C1=C([C@@H](C)CC)C=CC=C(NC)C1 |
| InChI | InChI=1S/C14H22N2/c1-5-11(3)13-9-7-8-12(15-4)10-14(13)16-6-2/h6-9,11,15H,5,10H2,1-4H3/b16-6+/t11-/m0/s1 |
| InChIKey | RJFACBLVQQJOEQ-MTTUFYGSSA-N |
| XLogP | 3.44 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|