C11H18N2 — CID 163592619
(4S)-4-[(E)-but-2-en-2-yl]-N-methyl-4,5-dihydro-3H-azepin-6-amine (PubChem CID 163592619) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is (4S)-4-[(E)-but-2-en-2-yl]-N-methyl-4,5-dihydro-3H-azepin-6-amine.
| Compound Name | (4S)-4-[(E)-but-2-en-2-yl]-N-methyl-4,5-dihydro-3H-azepin-6-amine |
|---|---|
| PubChem CID | 163592619 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | (4S)-4-[(E)-but-2-en-2-yl]-N-methyl-4,5-dihydro-3H-azepin-6-amine |
| SMILES | C/C=C(\C)[C@@H]1CC=NC=C(NC)C1 |
| InChI | InChI=1S/C11H18N2/c1-4-9(2)10-5-6-13-8-11(7-10)12-3/h4,6,8,10,12H,5,7H2,1-3H3/b9-4+/t10-/m1/s1 |
| InChIKey | GQTPFSAVHJMPIY-WXLQGSQKSA-N |
| XLogP | 2.49 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|