C19H36N2 — CID 123239793
2-[[(Z)-2-ethyl-5-methylhept-2-enylidene]amino]-N-methyloct-2-en-4-amine (PubChem CID 123239793) has the molecular formula C19H36N2 and a molecular weight of 292.51 g/mol. Its IUPAC name is 2-[[(Z)-2-ethyl-5-methylhept-2-enylidene]amino]-N-methyloct-2-en-4-amine.
| Compound Name | 2-[[(Z)-2-ethyl-5-methylhept-2-enylidene]amino]-N-methyloct-2-en-4-amine |
|---|---|
| PubChem CID | 123239793 |
| Molecular Formula | C19H36N2 |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.29 |
| IUPAC Name | 2-[[(Z)-2-ethyl-5-methylhept-2-enylidene]amino]-N-methyloct-2-en-4-amine |
| SMILES | CCCCC(C=C(C)/N=C/C(=C\CC(C)CC)CC)NC |
| InChI | InChI=1S/C19H36N2/c1-7-10-11-19(20-6)14-17(5)21-15-18(9-3)13-12-16(4)8-2/h13-16,19-20H,7-12H2,1-6H3/b17-14?,18-13-,21-15+ |
| InChIKey | MITLHEATZSXCOL-GBBCXWEWSA-N |
| XLogP | 5.51 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|