C12H20N2 — CID 123368831
N-methyl-1-(3,4,5-trimethyl-4H-azepin-7-yl)ethanamine (PubChem CID 123368831) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is N-methyl-1-(3,4,5-trimethyl-4H-azepin-7-yl)ethanamine.
| Compound Name | N-methyl-1-(3,4,5-trimethyl-4H-azepin-7-yl)ethanamine |
|---|---|
| PubChem CID | 123368831 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | N-methyl-1-(3,4,5-trimethyl-4H-azepin-7-yl)ethanamine |
| SMILES | CNC(C)C1=NC=C(C)C(C)C(C)=C1 |
| InChI | InChI=1S/C12H20N2/c1-8-6-12(11(4)13-5)14-7-9(2)10(8)3/h6-7,10-11,13H,1-5H3 |
| InChIKey | MRMXTRIQRCEOCD-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |