C15H30N2 — CID 126613745
2,6-dimethyl-N-propan-2-yl-5-propan-2-yliminohept-3-en-3-amine (PubChem CID 126613745) has the molecular formula C15H30N2 and a molecular weight of 238.42 g/mol. Its IUPAC name is 2,6-dimethyl-N-propan-2-yl-5-propan-2-yliminohept-3-en-3-amine.
| Compound Name | 2,6-dimethyl-N-propan-2-yl-5-propan-2-yliminohept-3-en-3-amine |
|---|---|
| PubChem CID | 126613745 |
| Molecular Formula | C15H30N2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.24 |
| IUPAC Name | 2,6-dimethyl-N-propan-2-yl-5-propan-2-yliminohept-3-en-3-amine |
| SMILES | CC(C)/N=C(/C=C(NC(C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C15H30N2/c1-10(2)14(16-12(5)6)9-15(11(3)4)17-13(7)8/h9-13,16H,1-8H3/b14-9?,17-15- |
| InChIKey | OXOBSWQLEHNKSO-OBUJNYITSA-N |
| XLogP | 4.03 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|