C25H36N4 — CID 143342506
6-[[[(4E)-5,6-dimethyl-3-[(E)-4-methyliminobut-2-en-2-yl]iminohepta-1,4,6-trien-2-yl]amino]methyl]-2-propylcyclohepta-1,4,6-trien-1-amine (PubChem CID 143342506) has the molecular formula C25H36N4 and a molecular weight of 392.59 g/mol. Its IUPAC name is 6-[[[(4E)-5,6-dimethyl-3-[(E)-4-methyliminobut-2-en-2-yl]iminohepta-1,4,6-trien-2-yl]amino]methyl]-2-propylcyclohepta-1,4,6-trien-1-amine.
| Compound Name | 6-[[[(4E)-5,6-dimethyl-3-[(E)-4-methyliminobut-2-en-2-yl]iminohepta-1,4,6-trien-2-yl]amino]methyl]-2-propylcyclohepta-1,4,6-trien-1-amine |
|---|---|
| PubChem CID | 143342506 |
| Molecular Formula | C25H36N4 |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | 6-[[[(4E)-5,6-dimethyl-3-[(E)-4-methyliminobut-2-en-2-yl]iminohepta-1,4,6-trien-2-yl]amino]methyl]-2-propylcyclohepta-1,4,6-trien-1-amine |
| SMILES | C=C(C)/C(C)=C/C(=N\C(C)=C\C=N\C)C(=C)NCC1=CC(N)=C(CCC)CC=C1 |
| InChI | InChI=1S/C25H36N4/c1-8-10-23-12-9-11-22(16-24(23)26)17-28-21(6)25(15-19(4)18(2)3)29-20(5)13-14-27-7/h9,11,13-16,28H,2,6,8,10,12,17,26H2,1,3-5,7H3/b19-15+,20-13+,27-14+,29-25+ |
| InChIKey | JIRYERDJSOLKOX-VEJBARKBSA-N |
| XLogP | 5.56 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|