C28H42N4 — CID 142952320
N-[(E)-3-aminobutan-2-ylideneamino]-N-but-1-en-2-yl-4-prop-1-en-2-ylcyclohepta-1,4,6-trien-1-amine;(2Z,5Z)-N,2-dimethyl-4-methylidenehepta-2,5-dien-1-imine (PubChem CID 142952320) has the molecular formula C28H42N4 and a molecular weight of 434.67 g/mol. Its IUPAC name is N-[(E)-3-aminobutan-2-ylideneamino]-N-but-1-en-2-yl-4-prop-1-en-2-ylcyclohepta-1,4,6-trien-1-amine;(2Z,5Z)-N,2-dimethyl-4-methylidenehepta-2,5-dien-1-imine.
| Compound Name | N-[(E)-3-aminobutan-2-ylideneamino]-N-but-1-en-2-yl-4-prop-1-en-2-ylcyclohepta-1,4,6-trien-1-amine;(2Z,5Z)-N,2-dimethyl-4-methylidenehepta-2,5-dien-1-imine |
|---|---|
| PubChem CID | 142952320 |
| Molecular Formula | C28H42N4 |
| Molecular Weight | 434.67 g/mol |
| Exact Mass | 434.34 |
| IUPAC Name | N-[(E)-3-aminobutan-2-ylideneamino]-N-but-1-en-2-yl-4-prop-1-en-2-ylcyclohepta-1,4,6-trien-1-amine;(2Z,5Z)-N,2-dimethyl-4-methylidenehepta-2,5-dien-1-imine |
| SMILES | C=C(/C=C\C)/C=C(C)\C=N\C.C=C(C)C1=CC=CC(N(/N=C(\C)C(C)N)C(=C)CC)=CC1 |
| InChI | InChI=1S/C18H27N3.C10H15N/c1-7-14(4)21(20-16(6)15(5)19)18-10-8-9-17(11-12-18)13(2)3;1-5-6-9(2)7-10(3)8-11-4/h8-10,12,15H,2,4,7,11,19H2,1,3,5-6H3;5-8H,2H2,1,3-4H3/b20-16+;6-5-,10-7-,11-8+ |
| InChIKey | RUGCJFXZBDIIKV-IWIQGSNZSA-N |
| XLogP | 7.05 |
| TPSA | 53.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.67 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|