C18H27N3 — CID 142952321
N-[(E)-3-aminobutan-2-ylideneamino]-N-but-1-en-2-yl-4-prop-1-en-2-ylcyclohepta-1,4,6-trien-1-amine (PubChem CID 142952321) has the molecular formula C18H27N3 and a molecular weight of 285.44 g/mol. Its IUPAC name is N-[(E)-3-aminobutan-2-ylideneamino]-N-but-1-en-2-yl-4-prop-1-en-2-ylcyclohepta-1,4,6-trien-1-amine.
| Compound Name | N-[(E)-3-aminobutan-2-ylideneamino]-N-but-1-en-2-yl-4-prop-1-en-2-ylcyclohepta-1,4,6-trien-1-amine |
|---|---|
| PubChem CID | 142952321 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | N-[(E)-3-aminobutan-2-ylideneamino]-N-but-1-en-2-yl-4-prop-1-en-2-ylcyclohepta-1,4,6-trien-1-amine |
| SMILES | C=C(C)C1=CC=CC(N(/N=C(\C)C(C)N)C(=C)CC)=CC1 |
| InChI | InChI=1S/C18H27N3/c1-7-14(4)21(20-16(6)15(5)19)18-10-8-9-17(11-12-18)13(2)3/h8-10,12,15H,2,4,7,11,19H2,1,3,5-6H3/b20-16+ |
| InChIKey | WRTWROWETHFPCT-CAPFRKAQSA-N |
| XLogP | 4.28 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|