C17H32N4 — CID 134386465
N'-[(3E)-5-methyl-3-(methyliminomethyl)-4-(pentan-2-ylideneamino)hexa-1,3-dien-2-yl]propane-1,3-diamine (PubChem CID 134386465) has the molecular formula C17H32N4 and a molecular weight of 292.47 g/mol. Its IUPAC name is N'-[(3E)-5-methyl-3-(methyliminomethyl)-4-(pentan-2-ylideneamino)hexa-1,3-dien-2-yl]propane-1,3-diamine.
| Compound Name | N'-[(3E)-5-methyl-3-(methyliminomethyl)-4-(pentan-2-ylideneamino)hexa-1,3-dien-2-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 134386465 |
| Molecular Formula | C17H32N4 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.26 |
| IUPAC Name | N'-[(3E)-5-methyl-3-(methyliminomethyl)-4-(pentan-2-ylideneamino)hexa-1,3-dien-2-yl]propane-1,3-diamine |
| SMILES | C=C(NCCCN)C(/C=N/C)=C(\N=C(/C)CCC)C(C)C |
| InChI | InChI=1S/C17H32N4/c1-7-9-14(4)21-17(13(2)3)16(12-19-6)15(5)20-11-8-10-18/h12-13,20H,5,7-11,18H2,1-4,6H3/b17-16-,19-12+,21-14+ |
| InChIKey | YJPHGJMESKWPEG-FWHMYIKCSA-N |
| XLogP | 3.31 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|