C23H38N6 — CID 176539137
2,10,19,25-tetramethyl-3,9,13,17,20,24-hexazabicyclo[9.7.7]pentacosa-1(19),2,10,12,17,24-hexaene (PubChem CID 176539137) has the molecular formula C23H38N6 and a molecular weight of 398.60 g/mol. Its IUPAC name is 2,10,19,25-tetramethyl-3,9,13,17,20,24-hexazabicyclo[9.7.7]pentacosa-1(19),2,10,12,17,24-hexaene.
| Compound Name | 2,10,19,25-tetramethyl-3,9,13,17,20,24-hexazabicyclo[9.7.7]pentacosa-1(19),2,10,12,17,24-hexaene |
|---|---|
| PubChem CID | 176539137 |
| Molecular Formula | C23H38N6 |
| Molecular Weight | 398.60 g/mol |
| Exact Mass | 398.32 |
| IUPAC Name | 2,10,19,25-tetramethyl-3,9,13,17,20,24-hexazabicyclo[9.7.7]pentacosa-1(19),2,10,12,17,24-hexaene |
| SMILES | CC1=C2/C=N\CCC/N=C/C(=C(C)NCCCCC/N=C\2C)/C(C)=N/CCCN1 |
| InChI | InChI=1S/C23H38N6/c1-18-22-16-24-10-8-11-25-17-23(19(2)27-13-7-5-6-12-26-18)21(4)29-15-9-14-28-20(22)3/h16-17,26,29H,5-15H2,1-4H3/b22-18?,23-21?,24-16+,25-17-,27-19-,28-20+ |
| InChIKey | HDYWFSDUCDZOBX-NZGKGWJPSA-N |
| XLogP | 3.75 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.60 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |