C25H42N6 — CID 57248922
2,3,9,10,12,18-hexamethyl-3,9,13,17,20,24-hexazabicyclo[9.7.7]pentacosa-1,10,12,17,19,24-hexaene (PubChem CID 57248922) has the molecular formula C25H42N6 and a molecular weight of 426.65 g/mol. Its IUPAC name is 2,3,9,10,12,18-hexamethyl-3,9,13,17,20,24-hexazabicyclo[9.7.7]pentacosa-1,10,12,17,19,24-hexaene.
| Compound Name | 2,3,9,10,12,18-hexamethyl-3,9,13,17,20,24-hexazabicyclo[9.7.7]pentacosa-1,10,12,17,19,24-hexaene |
|---|---|
| PubChem CID | 57248922 |
| Molecular Formula | C25H42N6 |
| Molecular Weight | 426.65 g/mol |
| Exact Mass | 426.35 |
| IUPAC Name | 2,3,9,10,12,18-hexamethyl-3,9,13,17,20,24-hexazabicyclo[9.7.7]pentacosa-1,10,12,17,19,24-hexaene |
| SMILES | CC1=C2/C=N\CCC/N=C/C(=C(C)N(C)CCCCCN1C)/C(C)=N/CCC/N=C\2C |
| InChI | InChI=1S/C25H42N6/c1-20-24-18-26-12-10-13-27-19-25(21(2)29-15-11-14-28-20)23(4)31(6)17-9-7-8-16-30(5)22(24)3/h18-19H,7-17H2,1-6H3/b24-22?,25-23?,26-18-,27-19+,28-20-,29-21+ |
| InChIKey | NFOVTUDEKIFJCA-KPMRHZNISA-N |
| XLogP | 4.44 |
| TPSA | 55.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.65 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |