C24H40N6 — CID 176518358
N,18,24-trimethyl-9-methylimino-12,16,19,23-tetrazabicyclo[8.7.7]tetracosa-1,10(24),11,16,18-pentaen-2-amine (PubChem CID 176518358) has the molecular formula C24H40N6 and a molecular weight of 412.63 g/mol. Its IUPAC name is N,18,24-trimethyl-9-methylimino-12,16,19,23-tetrazabicyclo[8.7.7]tetracosa-1,10(24),11,16,18-pentaen-2-amine.
| Compound Name | N,18,24-trimethyl-9-methylimino-12,16,19,23-tetrazabicyclo[8.7.7]tetracosa-1,10(24),11,16,18-pentaen-2-amine |
|---|---|
| PubChem CID | 176518358 |
| Molecular Formula | C24H40N6 |
| Molecular Weight | 412.63 g/mol |
| Exact Mass | 412.33 |
| IUPAC Name | N,18,24-trimethyl-9-methylimino-12,16,19,23-tetrazabicyclo[8.7.7]tetracosa-1,10(24),11,16,18-pentaen-2-amine |
| SMILES | C/N=C1\CCCCCCC(NC)=C2/C=N/CCC/N=C\C1=C(C)NCCC/N=C/2C |
| InChI | InChI=1S/C24H40N6/c1-19-21-17-27-13-9-14-28-18-22(20(2)30-16-10-15-29-19)24(26-4)12-8-6-5-7-11-23(21)25-3/h17-18,25,30H,5-16H2,1-4H3/b22-20?,23-21?,26-24+,27-17+,28-18-,29-19+ |
| InChIKey | UUEGKLXRKNHTBM-XLJGMRPSSA-N |
| XLogP | 4.14 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.63 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|