C23H42N4 — CID 142149416
(1Z,3E,5Z)-N-ethyl-2-(ethylideneamino)-4-[(4-heptan-2-ylpiperazin-1-yl)methyl]hepta-1,3,5-trien-1-amine (PubChem CID 142149416) has the molecular formula C23H42N4 and a molecular weight of 374.62 g/mol. Its IUPAC name is (1Z,3E,5Z)-N-ethyl-2-(ethylideneamino)-4-[(4-heptan-2-ylpiperazin-1-yl)methyl]hepta-1,3,5-trien-1-amine.
| Compound Name | (1Z,3E,5Z)-N-ethyl-2-(ethylideneamino)-4-[(4-heptan-2-ylpiperazin-1-yl)methyl]hepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 142149416 |
| Molecular Formula | C23H42N4 |
| Molecular Weight | 374.62 g/mol |
| Exact Mass | 374.34 |
| IUPAC Name | (1Z,3E,5Z)-N-ethyl-2-(ethylideneamino)-4-[(4-heptan-2-ylpiperazin-1-yl)methyl]hepta-1,3,5-trien-1-amine |
| SMILES | C/C=C\C(=C/C(=C/NCC)/N=C/C)CN1CCN(C(C)CCCCC)CC1 |
| InChI | InChI=1S/C23H42N4/c1-6-10-11-13-21(5)27-16-14-26(15-17-27)20-22(12-7-2)18-23(25-9-4)19-24-8-3/h7,9,12,18-19,21,24H,6,8,10-11,13-17,20H2,1-5H3/b12-7-,22-18+,23-19-,25-9+ |
| InChIKey | LVZUFODDUFHYID-XTPSBMHWSA-N |
| XLogP | 4.62 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.62 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|