C23H44N4 — CID 139514314
(3Z,5E)-5-N-(7-aminoheptan-2-yl)-1-N-(1-ethylpiperidin-4-yl)-5-N-methyl-2-methylidenehepta-3,5-diene-1,5-diamine (PubChem CID 139514314) has the molecular formula C23H44N4 and a molecular weight of 376.63 g/mol. Its IUPAC name is (3Z,5E)-5-N-(7-aminoheptan-2-yl)-1-N-(1-ethylpiperidin-4-yl)-5-N-methyl-2-methylidenehepta-3,5-diene-1,5-diamine.
| Compound Name | (3Z,5E)-5-N-(7-aminoheptan-2-yl)-1-N-(1-ethylpiperidin-4-yl)-5-N-methyl-2-methylidenehepta-3,5-diene-1,5-diamine |
|---|---|
| PubChem CID | 139514314 |
| Molecular Formula | C23H44N4 |
| Molecular Weight | 376.63 g/mol |
| Exact Mass | 376.36 |
| IUPAC Name | (3Z,5E)-5-N-(7-aminoheptan-2-yl)-1-N-(1-ethylpiperidin-4-yl)-5-N-methyl-2-methylidenehepta-3,5-diene-1,5-diamine |
| SMILES | C=C(/C=C\C(=C/C)N(C)C(C)CCCCCN)CNC1CCN(CC)CC1 |
| InChI | InChI=1S/C23H44N4/c1-6-23(26(5)21(4)11-9-8-10-16-24)13-12-20(3)19-25-22-14-17-27(7-2)18-15-22/h6,12-13,21-22,25H,3,7-11,14-19,24H2,1-2,4-5H3/b13-12-,23-6+ |
| InChIKey | UTFFIJFATFQIRO-XSDPPZHHSA-N |
| XLogP | 3.92 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.63 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|