C31H44N4 — CID 146037613
(1Z,3Z,5E,7Z,13Z,15E,17Z)-5,20-diethyl-4,9,10,14,15,19,21-heptamethyl-21,22-diazatricyclo[16.2.1.18,11]docosa-1,3,5,7,9,13,15,17,19-nonaene-3,13-diamine (PubChem CID 146037613) has the molecular formula C31H44N4 and a molecular weight of 472.72 g/mol. Its IUPAC name is (1Z,3Z,5E,7Z,13Z,15E,17Z)-5,20-diethyl-4,9,10,14,15,19,21-heptamethyl-21,22-diazatricyclo[16.2.1.18,11]docosa-1,3,5,7,9,13,15,17,19-nonaene-3,13-diamine.
| Compound Name | (1Z,3Z,5E,7Z,13Z,15E,17Z)-5,20-diethyl-4,9,10,14,15,19,21-heptamethyl-21,22-diazatricyclo[16.2.1.18,11]docosa-1,3,5,7,9,13,15,17,19-nonaene-3,13-diamine |
|---|---|
| PubChem CID | 146037613 |
| Molecular Formula | C31H44N4 |
| Molecular Weight | 472.72 g/mol |
| Exact Mass | 472.36 |
| IUPAC Name | (1Z,3Z,5E,7Z,13Z,15E,17Z)-5,20-diethyl-4,9,10,14,15,19,21-heptamethyl-21,22-diazatricyclo[16.2.1.18,11]docosa-1,3,5,7,9,13,15,17,19-nonaene-3,13-diamine |
| SMILES | CCC1=C\C=C2/NC(C/C(N)=C(C)/C(C)=C/C=c3/c(C)c(CC)/c(n3C)=C/C(N)=C/1C)C(C)=C2C |
| InChI | InChI=1S/C31H44N4/c1-10-24-13-14-28-20(5)21(6)29(34-28)16-26(32)19(4)18(3)12-15-30-23(8)25(11-2)31(35(30)9)17-27(33)22(24)7/h12-15,17,29,34H,10-11,16,32-33H2,1-9H3/b18-12+,24-13+,26-19-,27-22-,28-14-,30-15-,31-17- |
| InChIKey | DFLFVYSPENPGPB-FMPHSSFDSA-N |
| XLogP | 4.80 |
| TPSA | 69.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.72 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |