C17H26F3N5 — CID 146397201
(3E)-2-N-[(2E,4E)-5-(3,5-diaminocyclopenten-1-yl)-5-fluoropenta-2,4-dien-2-yl]-5,5-difluoro-3-(methylaminomethylidene)pent-1-ene-2,4-diamine (PubChem CID 146397201) has the molecular formula C17H26F3N5 and a molecular weight of 357.42 g/mol. Its IUPAC name is (3E)-2-N-[(2E,4E)-5-(3,5-diaminocyclopenten-1-yl)-5-fluoropenta-2,4-dien-2-yl]-5,5-difluoro-3-(methylaminomethylidene)pent-1-ene-2,4-diamine.
| Compound Name | (3E)-2-N-[(2E,4E)-5-(3,5-diaminocyclopenten-1-yl)-5-fluoropenta-2,4-dien-2-yl]-5,5-difluoro-3-(methylaminomethylidene)pent-1-ene-2,4-diamine |
|---|---|
| PubChem CID | 146397201 |
| Molecular Formula | C17H26F3N5 |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | (3E)-2-N-[(2E,4E)-5-(3,5-diaminocyclopenten-1-yl)-5-fluoropenta-2,4-dien-2-yl]-5,5-difluoro-3-(methylaminomethylidene)pent-1-ene-2,4-diamine |
| SMILES | C=C(N/C(C)=C/C=C(/F)C1=CC(N)CC1N)/C(=C/NC)C(N)C(F)F |
| InChI | InChI=1S/C17H26F3N5/c1-9(4-5-14(18)12-6-11(21)7-15(12)22)25-10(2)13(8-24-3)16(23)17(19)20/h4-6,8,11,15-17,24-25H,2,7,21-23H2,1,3H3/b9-4+,13-8-,14-5+ |
| InChIKey | GKKOWFVDGQOJJH-QRCYECORSA-N |
| XLogP | 1.53 |
| TPSA | 102.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|