C23H37FN2 — CID 156641308
N-[1-(5-fluoro-4-methylcyclohexa-1,3-dien-1-yl)but-3-en-2-yl]-7-piperidin-1-ylhept-1-en-2-amine (PubChem CID 156641308) has the molecular formula C23H37FN2 and a molecular weight of 360.56 g/mol. Its IUPAC name is N-[1-(5-fluoro-4-methylcyclohexa-1,3-dien-1-yl)but-3-en-2-yl]-7-piperidin-1-ylhept-1-en-2-amine.
| Compound Name | N-[1-(5-fluoro-4-methylcyclohexa-1,3-dien-1-yl)but-3-en-2-yl]-7-piperidin-1-ylhept-1-en-2-amine |
|---|---|
| PubChem CID | 156641308 |
| Molecular Formula | C23H37FN2 |
| Molecular Weight | 360.56 g/mol |
| Exact Mass | 360.29 |
| IUPAC Name | N-[1-(5-fluoro-4-methylcyclohexa-1,3-dien-1-yl)but-3-en-2-yl]-7-piperidin-1-ylhept-1-en-2-amine |
| SMILES | C=CC(CC1=CC=C(C)C(F)C1)NC(=C)CCCCCN1CCCCC1 |
| InChI | InChI=1S/C23H37FN2/c1-4-22(17-21-13-12-19(2)23(24)18-21)25-20(3)11-7-5-8-14-26-15-9-6-10-16-26/h4,12-13,22-23,25H,1,3,5-11,14-18H2,2H3 |
| InChIKey | PCCDMIPZTPGMDT-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.56 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|